Products 537-49-5
CAS 537-49-5 appears in our catalog under these names: N-Methyl-l-tyrosine, 95%, N-Methyl-L-tyrosine, N–Me–Tyr–OH, N-Methyl-L-tyrosine - Combretum collinum, N-Methyl-L-tyrosine, 95%+, 95%+. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg, 500mg, 1000mg, 2000mg, 25 mg.
(2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid (CAS 537-49-5) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid. InChIKey: AXDLCFOOGCNDST-VIFPVBQESA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-2-(methylamino)propanoic acid |
| InChIKey | AXDLCFOOGCNDST-VIFPVBQESA-N |
| SMILES | CN[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)