Products 1783663-54-6

CAS 1783663-54-6 is the registry number for 3-Cyclopentylmethyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(cyclopentylmethyl)benzoic acid (CAS 1783663-54-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 3-(cyclopentylmethyl)benzoic acid. InChIKey: KPBOPTLABRGNHG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O2
Molecular weight204.26 g/mol
IUPAC name3-(cyclopentylmethyl)benzoic acid
InChIKeyKPBOPTLABRGNHG-UHFFFAOYSA-N
SMILESC1CCC(C1)CC2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)