CAS 17839-48-4 appears in our catalog under these names: 3-Amino-2-hydroxybenzoic acid hydrochloride, 98%, Mesalazine (Mesalamine) EP Impurity F HCl. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-2-hydroxybenzoic acid;hydrochloride (CAS 17839-48-4) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 3-amino-2-hydroxybenzoic acid;hydrochloride. InChIKey: XTUHHRQWNJCPGG-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3 |
|---|---|
| Molecular weight | 189.59 g/mol |
| IUPAC name | 3-amino-2-hydroxybenzoic acid;hydrochloride |
| InChIKey | XTUHHRQWNJCPGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)O)C(=O)O.Cl |
Computed by PubChem (NCBI)