Products 1783942-93-7
CAS 1783942-93-7 is the registry number for 2-(2-(Difluoromethyl)-1,3-oxazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-(difluoromethyl)-1,3-oxazol-4-yl]acetic acid (CAS 1783942-93-7) is a chemical compound with the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. IUPAC name: 2-[2-(difluoromethyl)-1,3-oxazol-4-yl]acetic acid. InChIKey: SCOMMIQPAWLNCV-UHFFFAOYSA-N.
| Molecular formula | C6H5F2NO3 |
|---|---|
| Molecular weight | 177.11 g/mol |
| IUPAC name | 2-[2-(difluoromethyl)-1,3-oxazol-4-yl]acetic acid |
| InChIKey | SCOMMIQPAWLNCV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(O1)C(F)F)CC(=O)O |
Computed by PubChem (NCBI)