Products 1864339-54-7
CAS 1864339-54-7 is the registry number for 4-(Difluoromethyl)-2-methyloxazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(difluoromethyl)-2-methyl-1,3-oxazole-5-carboxylic acid (CAS 1864339-54-7) is a chemical compound with the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. IUPAC name: 4-(difluoromethyl)-2-methyl-1,3-oxazole-5-carboxylic acid. InChIKey: PCGVWUYNEATDLT-UHFFFAOYSA-N.
| Molecular formula | C6H5F2NO3 |
|---|---|
| Molecular weight | 177.11 g/mol |
| IUPAC name | 4-(difluoromethyl)-2-methyl-1,3-oxazole-5-carboxylic acid |
| InChIKey | PCGVWUYNEATDLT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)