Products 2452464-95-6
CAS 2452464-95-6 is the registry number for 3-(2,2-Difluoroethyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylic acid (CAS 2452464-95-6) is a chemical compound with the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. IUPAC name: 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylic acid. InChIKey: NTEWJRJYPRSVEV-UHFFFAOYSA-N.
| Molecular formula | C6H5F2NO3 |
|---|---|
| Molecular weight | 177.11 g/mol |
| IUPAC name | 3-(2,2-difluoroethyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | NTEWJRJYPRSVEV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NO1)CC(F)F)C(=O)O |
Computed by PubChem (NCBI)