Products 1783945-29-8

CAS 1783945-29-8 appears in our catalog under these names: (3,3-Difluoropiperidin-4-yl)methanol hydrochloride, 95%, (3,3-difluoropiperidin-4-yl)methanol hcl, (3,3-Difluoropiperidin-4-yl)methanol hydrochloride 98%, (3,3-Difluoropiperidin-4-yl)methanol hydrochloride, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg, 500mg, 5g.

Structural formula: {0} (CAS {1})

(3,3-difluoropiperidin-4-yl)methanol;hydrochloride (CAS 1783945-29-8) is a chemical compound with the molecular formula C6H12ClF2NO and a molecular weight of 187.61 g/mol. IUPAC name: (3,3-difluoropiperidin-4-yl)methanol;hydrochloride. InChIKey: IWIOBEMDKUELNI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClF2NO
Molecular weight187.61 g/mol
IUPAC name(3,3-difluoropiperidin-4-yl)methanol;hydrochloride
InChIKeyIWIOBEMDKUELNI-UHFFFAOYSA-N
SMILESC1CNCC(C1CO)(F)F.Cl

Computed by PubChem (NCBI)