CAS 2903435-02-7 is the registry number for rel-(3R,5S)-4,4-Difluoro-5-methylpiperidin-3-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S)-4,4-difluoro-5-methylpiperidin-3-ol;hydrochloride (CAS 2903435-02-7) is a chemical compound with the molecular formula C6H12ClF2NO and a molecular weight of 187.61 g/mol. IUPAC name: (3R,5S)-4,4-difluoro-5-methylpiperidin-3-ol;hydrochloride. InChIKey: MGZOTPDBZHAITB-UYXJWNHNSA-N.
| Molecular formula | C6H12ClF2NO |
|---|---|
| Molecular weight | 187.61 g/mol |
| IUPAC name | (3R,5S)-4,4-difluoro-5-methylpiperidin-3-ol;hydrochloride |
| InChIKey | MGZOTPDBZHAITB-UYXJWNHNSA-N |
| SMILES | C[C@H]1CNC[C@H](C1(F)F)O.Cl |
Computed by PubChem (NCBI)