Products 2802522-88-7
CAS 2802522-88-7 appears in our catalog under these names: Rel-(1R,2S) 2-Amino-5,5-difluoro-Cyclohexanol Hydrochloride, Rel-(1R,2S)-2-amino-5,5-difluorocyclohexan-1-ol hydrochloride, 97%, Rel-(1R,2S)-2-amino-5,5-difluorocyclohexan-1-ol hydrochloride, 97%, 97%. Offered by: TRC, AmBeed, Chemat. Available pack sizes: 500mg, 1g, 100mg, 250mg.
Cis-(1R,2S)-2-amino-5,5-difluorocyclohexan-1-ol;hydrochloride (CAS 2802522-88-7) is a chemical compound with the molecular formula C6H12ClF2NO and a molecular weight of 187.61 g/mol. IUPAC name: cis-(1R,2S)-2-amino-5,5-difluorocyclohexan-1-ol;hydrochloride. InChIKey: OQORPJLMXFZJII-UYXJWNHNSA-N.
| Molecular formula | C6H12ClF2NO |
|---|---|
| Molecular weight | 187.61 g/mol |
| IUPAC name | cis-(1R,2S)-2-amino-5,5-difluorocyclohexan-1-ol;hydrochloride |
| InChIKey | OQORPJLMXFZJII-UYXJWNHNSA-N |
| SMILES | C1CC(C[C@H]([C@H]1N)O)(F)F.Cl |
Computed by PubChem (NCBI)