CAS 1784008-01-0 appears in our catalog under these names: 5-Chloro-2,4-Diamine-6-Piperidin-Pyrimidine, 5-Chloro-6-(piperidin-1-yl)pyrimidine-2,4-diamine. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 10mg, 4x25mg, 25mg.
5-chloro-6-piperidin-1-ylpyrimidine-2,4-diamine (CAS 1784008-01-0) is a chemical compound with the molecular formula C9H14ClN5 and a molecular weight of 227.69 g/mol. IUPAC name: 5-chloro-6-piperidin-1-ylpyrimidine-2,4-diamine. InChIKey: JCJPNWRHNOOZBK-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN5 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 5-chloro-6-piperidin-1-ylpyrimidine-2,4-diamine |
| InChIKey | JCJPNWRHNOOZBK-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC(=NC(=C2Cl)N)N |
Computed by PubChem (NCBI)