CAS 1986791-73-4 is the registry number for [2-(5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethanamine;hydrochloride (CAS 1986791-73-4) is a chemical compound with the molecular formula C9H14ClN5 and a molecular weight of 227.69 g/mol. IUPAC name: 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethanamine;hydrochloride. InChIKey: UGVFLCASCSDTHR-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN5 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)ethanamine;hydrochloride |
| InChIKey | UGVFLCASCSDTHR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)CCN)C.Cl |
Computed by PubChem (NCBI)