CAS 22936-86-3 appears in our catalog under these names: Cyprazine, 6-Chloro-N2-cyclopropyl-N4-(propan-2-yl)-1,3,5-triazine-2,4-diamine, Cyprazine, Concentration: 100 µg/ml Solvent: Ethyl acetate. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 100mg, 0,5g, 50mg, 1x1ml.
6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (CAS 22936-86-3) is a chemical compound with the molecular formula C9H14ClN5 and a molecular weight of 227.69 g/mol. IUPAC name: 6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine. InChIKey: OOHIAOSLOGDBCE-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN5 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6-chloro-4-N-cyclopropyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| InChIKey | OOHIAOSLOGDBCE-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=NC(=NC(=N1)NC2CC2)Cl |
Computed by PubChem (NCBI)