CAS 1784253-99-1 is the registry number for 2–Bromo–5–(4–methoxyphenyl)–1H–pyrrole. Offered by: GLPBio. Available pack sizes: 100mg.
2-bromo-5-(4-methoxyphenyl)-1H-pyrrole (CAS 1784253-99-1) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 2-bromo-5-(4-methoxyphenyl)-1H-pyrrole. InChIKey: IMHSUEAKJHSWHI-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 2-bromo-5-(4-methoxyphenyl)-1H-pyrrole |
| InChIKey | IMHSUEAKJHSWHI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(N2)Br |
Computed by PubChem (NCBI)