Products 1784572-08-2
CAS 1784572-08-2 is the registry number for 2-(1-{1-[(tert-butoxy)carbonyl]azetidin-3-yl}-1H-pyrazol-5-yl)acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrazol-3-yl]acetic acid (CAS 1784572-08-2) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrazol-3-yl]acetic acid. InChIKey: HCFGINUHTHAHAO-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 2-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]pyrazol-3-yl]acetic acid |
| InChIKey | HCFGINUHTHAHAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N2C(=CC=N2)CC(=O)O |
Computed by PubChem (NCBI)