CAS 1784665-86-6 is the registry number for 4-Bromo-2-fluoro-3-methoxy-5-methylbenzaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
4-bromo-2-fluoro-3-methoxy-5-methylbenzaldehyde (CAS 1784665-86-6) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 4-bromo-2-fluoro-3-methoxy-5-methylbenzaldehyde. InChIKey: QCHDSTBSXGGTHS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-methoxy-5-methylbenzaldehyde |
| InChIKey | QCHDSTBSXGGTHS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Br)OC)F)C=O |
Computed by PubChem (NCBI)