Products 1784974-65-7
CAS 1784974-65-7 is the registry number for 1-(2-Bromo-4-chlorophenyl)-1H-1,2,3-triazole, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2-bromo-4-chlorophenyl)triazole (CAS 1784974-65-7) is a chemical compound with the molecular formula C8H5BrClN3 and a molecular weight of 258.50 g/mol. IUPAC name: 1-(2-bromo-4-chlorophenyl)triazole. InChIKey: FLOBLNVVPKIPHO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3 |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 1-(2-bromo-4-chlorophenyl)triazole |
| InChIKey | FLOBLNVVPKIPHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)N2C=CN=N2 |
Computed by PubChem (NCBI)