CAS 2566879-40-9 appears in our catalog under these names: 7-Bromo-3-chloro-1,5-naphthyridin-2-amine, 98%, 7-bromo-3-chloro-1,5-naphthyridin-2-amine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
7-bromo-3-chloro-1,5-naphthyridin-2-amine (CAS 2566879-40-9) is a chemical compound with the molecular formula C8H5BrClN3 and a molecular weight of 258.50 g/mol. IUPAC name: 7-bromo-3-chloro-1,5-naphthyridin-2-amine. InChIKey: BXMHLRYRPUUGOU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3 |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 7-bromo-3-chloro-1,5-naphthyridin-2-amine |
| InChIKey | BXMHLRYRPUUGOU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=CC(=C(N=C21)N)Cl)Br |
Computed by PubChem (NCBI)