Products 2413682-62-7
CAS 2413682-62-7 is the registry number for 6-Bromo-8-chlorocinnolin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-chlorocinnolin-3-amine (CAS 2413682-62-7) is a chemical compound with the molecular formula C8H5BrClN3 and a molecular weight of 258.50 g/mol. IUPAC name: 6-bromo-8-chlorocinnolin-3-amine. InChIKey: AXDXNSUERDCWEZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN3 |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 6-bromo-8-chlorocinnolin-3-amine |
| InChIKey | AXDXNSUERDCWEZ-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=NC2=C(C=C1Br)Cl)N |
Computed by PubChem (NCBI)