Products 1785112-48-2

CAS 1785112-48-2 is the registry number for 5-Cyclobutyl-1,2-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-cyclobutyl-1,2-oxazole-4-carboxylic acid (CAS 1785112-48-2) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 5-cyclobutyl-1,2-oxazole-4-carboxylic acid. InChIKey: GIWOUAPBYZJDHV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO3
Molecular weight167.16 g/mol
IUPAC name5-cyclobutyl-1,2-oxazole-4-carboxylic acid
InChIKeyGIWOUAPBYZJDHV-UHFFFAOYSA-N
SMILESC1CC(C1)C2=C(C=NO2)C(=O)O

Computed by PubChem (NCBI)