CAS 1785112-48-2 is the registry number for 5-Cyclobutyl-1,2-oxazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-cyclobutyl-1,2-oxazole-4-carboxylic acid (CAS 1785112-48-2) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 5-cyclobutyl-1,2-oxazole-4-carboxylic acid. InChIKey: GIWOUAPBYZJDHV-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 5-cyclobutyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | GIWOUAPBYZJDHV-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=C(C=NO2)C(=O)O |
Computed by PubChem (NCBI)