CAS 178547-10-9 is the registry number for 2-benzyl-6-bromophenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-benzyl-6-bromophenol (CAS 178547-10-9) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. IUPAC name: 2-benzyl-6-bromophenol. InChIKey: QKGFTPQUWZTRBY-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 2-benzyl-6-bromophenol |
| InChIKey | QKGFTPQUWZTRBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C(=CC=C2)Br)O |
Computed by PubChem (NCBI)