CAS 1785558-20-4 is the registry number for (4-(4-Bromophenyl)piperidin-1-yl)(cyclobutyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-(4-bromophenyl)piperidin-1-yl]-cyclobutylmethanone (CAS 1785558-20-4) is a chemical compound with the molecular formula C16H20BrNO and a molecular weight of 322.24 g/mol. IUPAC name: [4-(4-bromophenyl)piperidin-1-yl]-cyclobutylmethanone. InChIKey: WHYQPISCNQWFFI-UHFFFAOYSA-N.
| Molecular formula | C16H20BrNO |
|---|---|
| Molecular weight | 322.24 g/mol |
| IUPAC name | [4-(4-bromophenyl)piperidin-1-yl]-cyclobutylmethanone |
| InChIKey | WHYQPISCNQWFFI-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)N2CCC(CC2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)