Products 1794941-97-1
CAS 1794941-97-1 is the registry number for 6-Hydroxy Bromantane-d5. Offered by: TRC. Available pack sizes: 25mg.
6-(4-bromo-2,3,5,6-tetradeuterioanilino)-6-deuterioadamantan-2-ol (CAS 1794941-97-1) is a chemical compound with the molecular formula C16H20BrNO and a molecular weight of 327.27 g/mol. IUPAC name: 6-(4-bromo-2,3,5,6-tetradeuterioanilino)-6-deuterioadamantan-2-ol. InChIKey: VALMSWJHKMROEO-FQPFGFDGSA-N.
| Molecular formula | C16H20BrNO |
|---|---|
| Molecular weight | 327.27 g/mol |
| IUPAC name | 6-(4-bromo-2,3,5,6-tetradeuterioanilino)-6-deuterioadamantan-2-ol |
| InChIKey | VALMSWJHKMROEO-FQPFGFDGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC2(C3CC4CC2CC(C3)C4O)[2H])[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)
Synonyms:
6-Hydroxy Bromantane-d5