CAS 560070-28-2 is the registry number for 5-Hydroxy Bromantane, >95% (HPLC). Offered by: TRC. Available pack sizes: 5mg.
4-(4-bromoanilino)adamantan-1-ol (CAS 560070-28-2) is a chemical compound with the molecular formula C16H20BrNO and a molecular weight of 322.24 g/mol. IUPAC name: 4-(4-bromoanilino)adamantan-1-ol. InChIKey: MVLNUULFHPBESA-UHFFFAOYSA-N.
| Molecular formula | C16H20BrNO |
|---|---|
| Molecular weight | 322.24 g/mol |
| IUPAC name | 4-(4-bromoanilino)adamantan-1-ol |
| InChIKey | MVLNUULFHPBESA-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC(C2)(CC1C3NC4=CC=C(C=C4)Br)O |
Computed by PubChem (NCBI)