Products 1785614-98-3
CAS 1785614-98-3 appears in our catalog under these names: 2–(3，4–dichlorophenyl)–2，2–difluoroethan–1–ol, 2-(3,4-Dichlorophenyl)-2,2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 1g, 5g.
2-(3,4-dichlorophenyl)-2,2-difluoroethanol (CAS 1785614-98-3) is a chemical compound with the molecular formula C8H6Cl2F2O and a molecular weight of 227.03 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2,2-difluoroethanol. InChIKey: UXXYYGYKNRKKEM-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F2O |
|---|---|
| Molecular weight | 227.03 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2,2-difluoroethanol |
| InChIKey | UXXYYGYKNRKKEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CO)(F)F)Cl)Cl |
Computed by PubChem (NCBI)