Products 1823847-79-5
CAS 1823847-79-5 appears in our catalog under these names: 2–(2，4–dichlorophenyl)–2，2–difluoroethan–1–ol, 2-(2，4-dichlorophenyl)-2，2-difluoroethan-1-ol, 2-(2,4-dichlorophenyl)-2,2-difluoroethan-1-ol, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
2-(2,4-dichlorophenyl)-2,2-difluoroethanol (CAS 1823847-79-5) is a chemical compound with the molecular formula C8H6Cl2F2O and a molecular weight of 227.03 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2,2-difluoroethanol. InChIKey: HXZNMTLCMCWDMB-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F2O |
|---|---|
| Molecular weight | 227.03 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2,2-difluoroethanol |
| InChIKey | HXZNMTLCMCWDMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CO)(F)F |
Computed by PubChem (NCBI)