Products 1866555-86-3
CAS 1866555-86-3 is the registry number for 2,4-dichloro-1-(2,2-difluoroethoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,4-dichloro-1-(2,2-difluoroethoxy)benzene (CAS 1866555-86-3) is a chemical compound with the molecular formula C8H6Cl2F2O and a molecular weight of 227.03 g/mol. IUPAC name: 2,4-dichloro-1-(2,2-difluoroethoxy)benzene. InChIKey: XFZYGYYAMBGJPP-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2F2O |
|---|---|
| Molecular weight | 227.03 g/mol |
| IUPAC name | 2,4-dichloro-1-(2,2-difluoroethoxy)benzene |
| InChIKey | XFZYGYYAMBGJPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(F)F |
Computed by PubChem (NCBI)