Products 1785761-33-2
CAS 1785761-33-2 is the registry number for tert-Butyl 5-formyl-4-hydroxy-3,6-dihydropyridine-1(2h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 3-(hydroxymethylidene)-4-oxopiperidine-1-carboxylate (CAS 1785761-33-2) is a chemical compound with the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. IUPAC name: tert-butyl 3-(hydroxymethylidene)-4-oxopiperidine-1-carboxylate. InChIKey: WUGBZQDKIBIXGS-UHFFFAOYSA-N.
| Molecular formula | C11H17NO4 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethylidene)-4-oxopiperidine-1-carboxylate |
| InChIKey | WUGBZQDKIBIXGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(=CO)C1 |
Computed by PubChem (NCBI)