CAS 1785762-28-8 is the registry number for Phenyl 4-([(2,2-dimethylpropyl)amino]carbonyl)-1h-imidazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate (CAS 1785762-28-8) is a chemical compound with the molecular formula C16H19N3O3 and a molecular weight of 301.34 g/mol. IUPAC name: phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate. InChIKey: RNFLLRTWWIQDSH-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O3 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | phenyl 4-(2,2-dimethylpropylcarbamoyl)-1H-imidazole-5-carboxylate |
| InChIKey | RNFLLRTWWIQDSH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CNC(=O)C1=C(NC=N1)C(=O)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)