CAS 2231303-83-4 is the registry number for 4-(((3-Methyl-1-(4-methylphenyl)-1H-pyrazol-5-yl)carbonyl)amino)butanoic Acid. Offered by: TRC. Available pack sizes: 1g.
4-[[5-methyl-2-(4-methylphenyl)pyrazole-3-carbonyl]amino]butanoic acid (CAS 2231303-83-4) is a chemical compound with the molecular formula C16H19N3O3 and a molecular weight of 301.34 g/mol. IUPAC name: 4-[[5-methyl-2-(4-methylphenyl)pyrazole-3-carbonyl]amino]butanoic acid. InChIKey: FFXSAZCASQZBRZ-UHFFFAOYSA-N.
| Molecular formula | C16H19N3O3 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 4-[[5-methyl-2-(4-methylphenyl)pyrazole-3-carbonyl]amino]butanoic acid |
| InChIKey | FFXSAZCASQZBRZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C)C(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)