CAS 313369-16-3 is the registry number for Lumateperone Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (10R,15S)-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate (CAS 313369-16-3) is a chemical compound with the molecular formula C16H19N3O3 and a molecular weight of 301.34 g/mol. IUPAC name: ethyl (10R,15S)-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate. InChIKey: QXNQHNWWRRMQPS-AAEUAGOBSA-N.
| Molecular formula | C16H19N3O3 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | ethyl (10R,15S)-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
| InChIKey | QXNQHNWWRRMQPS-AAEUAGOBSA-N |
| SMILES | CCOC(=O)N1CC[C@H]2[C@@H](C1)C3=C4N2CC(=O)NC4=CC=C3 |
Computed by PubChem (NCBI)