CAS 178614-85-2 is the registry number for Valine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (4R)-2,5-dioxo-4-propan-2-yl-1,3-oxazolidine-3-carboxylate (CAS 178614-85-2) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: benzyl (4R)-2,5-dioxo-4-propan-2-yl-1,3-oxazolidine-3-carboxylate. InChIKey: PBXWOGVKYLPBQY-LLVKDONJSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | benzyl (4R)-2,5-dioxo-4-propan-2-yl-1,3-oxazolidine-3-carboxylate |
| InChIKey | PBXWOGVKYLPBQY-LLVKDONJSA-N |
| SMILES | CC(C)[C@@H]1C(=O)OC(=O)N1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)