Products 893730-00-2
CAS 893730-00-2 appears in our catalog under these names: Methyl 3-formyl-4,6-dimethoxy-1-methyl-1h-indole-2-carboxylate, 95%, Methyl 3-formyl-4,6-dimethoxy-1-methyl-1H-indole-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg.
Methyl 3-formyl-4,6-dimethoxy-1-methylindole-2-carboxylate (CAS 893730-00-2) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: methyl 3-formyl-4,6-dimethoxy-1-methylindole-2-carboxylate. InChIKey: BAUVXKRFXRVZPA-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | methyl 3-formyl-4,6-dimethoxy-1-methylindole-2-carboxylate |
| InChIKey | BAUVXKRFXRVZPA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC(=C2)OC)OC)C(=C1C(=O)OC)C=O |
Computed by PubChem (NCBI)