CAS 924844-13-3 appears in our catalog under these names: (5,8-Dimethoxy-4-methyl-2-oxoquinolin-1(2h)-yl)acetic acid, 95%, 2-(5,8-Dimethoxy-4-methyl-2-oxoquinolin-1(2H)-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(5,8-dimethoxy-4-methyl-2-oxoquinolin-1-yl)acetic acid (CAS 924844-13-3) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: 2-(5,8-dimethoxy-4-methyl-2-oxoquinolin-1-yl)acetic acid. InChIKey: AQMQHWYRBAAIET-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | 2-(5,8-dimethoxy-4-methyl-2-oxoquinolin-1-yl)acetic acid |
| InChIKey | AQMQHWYRBAAIET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=C(C=CC(=C12)OC)OC)CC(=O)O |
Computed by PubChem (NCBI)