CAS 1788624-28-1 appears in our catalog under these names: 7-(Aminomethyl)-1,4-dihydroquinolin-4-one hydrochloride, 95%, 7-(Aminomethyl)-1,4-dihydroquinolin-4-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-(aminomethyl)-1H-quinolin-4-one;hydrochloride (CAS 1788624-28-1) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 7-(aminomethyl)-1H-quinolin-4-one;hydrochloride. InChIKey: XSOHUPKMWVRNNY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 7-(aminomethyl)-1H-quinolin-4-one;hydrochloride |
| InChIKey | XSOHUPKMWVRNNY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CN)NC=CC2=O.Cl |
Computed by PubChem (NCBI)