Products 178880-04-1

CAS 178880-04-1 is the registry number for 3-Sulfamoyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-sulfamoyl-1H-pyrazole-4-carboxylic acid (CAS 178880-04-1) is a chemical compound with the molecular formula C4H5N3O4S and a molecular weight of 191.17 g/mol. IUPAC name: 5-sulfamoyl-1H-pyrazole-4-carboxylic acid. InChIKey: FTYKACFNSGUTDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5N3O4S
Molecular weight191.17 g/mol
IUPAC name5-sulfamoyl-1H-pyrazole-4-carboxylic acid
InChIKeyFTYKACFNSGUTDJ-UHFFFAOYSA-N
SMILESC1=NNC(=C1C(=O)O)S(=O)(=O)N

Computed by PubChem (NCBI)