CAS 1909327-98-5 is the registry number for 5-Sulfamoyl-1,2-oxazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-sulfamoyl-1,2-oxazole-3-carboxamide (CAS 1909327-98-5) is a chemical compound with the molecular formula C4H5N3O4S and a molecular weight of 191.17 g/mol. IUPAC name: 5-sulfamoyl-1,2-oxazole-3-carboxamide. InChIKey: MLWWHEXGCBOCAG-UHFFFAOYSA-N.
| Molecular formula | C4H5N3O4S |
|---|---|
| Molecular weight | 191.17 g/mol |
| IUPAC name | 5-sulfamoyl-1,2-oxazole-3-carboxamide |
| InChIKey | MLWWHEXGCBOCAG-UHFFFAOYSA-N |
| SMILES | C1=C(ON=C1C(=O)N)S(=O)(=O)N |
Computed by PubChem (NCBI)