CAS 2172947-78-1 is the registry number for 3-Nitro-1H-pyrrole-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-nitropyrrole-1-sulfonamide (CAS 2172947-78-1) is a chemical compound with the molecular formula C4H5N3O4S and a molecular weight of 191.17 g/mol. IUPAC name: 3-nitropyrrole-1-sulfonamide. InChIKey: SGCZZIBZNHYPHD-UHFFFAOYSA-N.
| Molecular formula | C4H5N3O4S |
|---|---|
| Molecular weight | 191.17 g/mol |
| IUPAC name | 3-nitropyrrole-1-sulfonamide |
| InChIKey | SGCZZIBZNHYPHD-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1[N+](=O)[O-])S(=O)(=O)N |
Computed by PubChem (NCBI)