Products 179023-39-3
CAS 179023-39-3 is the registry number for Benzyl 6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Benzyl 6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 179023-39-3) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: benzyl 6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: LYGRBXMEVAZBQH-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | benzyl 6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | LYGRBXMEVAZBQH-UHFFFAOYSA-N |
| SMILES | C1C2CC(=O)C1N(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)