Products 2816820-66-1
CAS 2816820-66-1 is the registry number for benzyl (1R,4S)-6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Benzyl (1R,4S)-6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 2816820-66-1) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: benzyl (1R,4S)-6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: LYGRBXMEVAZBQH-NWDGAFQWSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | benzyl (1R,4S)-6-oxo-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | LYGRBXMEVAZBQH-NWDGAFQWSA-N |
| SMILES | C1[C@H]2CC(=O)[C@@H]1N(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)