CAS 179062-02-3 appears in our catalog under these names: 5–Fluoro–3–(trifluoromethyl)benzene–1,2–diamine, 5-Fluoro-3-(trifluoromethyl)benzene-1,2-diamine, 97%, 2,3-Diamino-5-fluorobenzotrifluoride, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-fluoro-3-(trifluoromethyl)benzene-1,2-diamine (CAS 179062-02-3) is a chemical compound with the molecular formula C7H6F4N2 and a molecular weight of 194.13 g/mol. IUPAC name: 5-fluoro-3-(trifluoromethyl)benzene-1,2-diamine. InChIKey: HGBKWCAURJPXQP-UHFFFAOYSA-N.
| Molecular formula | C7H6F4N2 |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | 5-fluoro-3-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | HGBKWCAURJPXQP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)N)F |
Computed by PubChem (NCBI)