CAS 179075-88-8 appears in our catalog under these names: 1–Butyl–3–methylimidazolium nitrate, 1H-Imidazolium, 3-butyl-1-methyl-, nitrate (1:1), >95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g.
1-butyl-3-methylimidazol-3-ium nitrate (CAS 179075-88-8) is a chemical compound with the molecular formula C8H15N3O3 and a molecular weight of 201.22 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium nitrate. InChIKey: WPHIMOZSRUCGGU-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O3 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium nitrate |
| InChIKey | WPHIMOZSRUCGGU-UHFFFAOYSA-N |
| SMILES | CCCCN1C=C[N+](=C1)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)