CAS 1793059-78-5 is the registry number for tert-Butyl 4-aminobenzoate-13C6. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
Tert-butyl 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 1793059-78-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 199.20 g/mol. IUPAC name: tert-butyl 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: KYORUZMJUKHKFS-VFESMUGCSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | tert-butyl 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | KYORUZMJUKHKFS-VFESMUGCSA-N |
| SMILES | CC(C)(C)OC(=O)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)N |
Computed by PubChem (NCBI)