CAS 1794153-77-7 appears in our catalog under these names: 2,8-Dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine, 97%, 2,8-Dimethyl-6-nitro-(1,2,4)triazolo(1,5-a)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2,8-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine (CAS 1794153-77-7) is a chemical compound with the molecular formula C8H8N4O2 and a molecular weight of 192.17 g/mol. IUPAC name: 2,8-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: ILMVTBWTHIMKBP-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2,8-dimethyl-6-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | ILMVTBWTHIMKBP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=N2)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)