CAS 1639115-99-3 appears in our catalog under these names: 3,8-Dimethyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine, 97%, 3,8-dimethyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine, 97%, 97%, 1,2,4-triazolo[4,3-a]pyridin-6-nitro, 3,8-dimethyl-, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg, 500mg.
3,8-dimethyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine (CAS 1639115-99-3) is a chemical compound with the molecular formula C8H8N4O2 and a molecular weight of 192.17 g/mol. IUPAC name: 3,8-dimethyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: GKMNUWYJEWYKIS-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3,8-dimethyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | GKMNUWYJEWYKIS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NN=C2C)[N+](=O)[O-] |
Computed by PubChem (NCBI)