Products 1031577-44-2
CAS 1031577-44-2 is the registry number for 1,7-Dimethylpyrimido[4,5-d]pyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione (CAS 1031577-44-2) is a chemical compound with the molecular formula C8H8N4O2 and a molecular weight of 192.17 g/mol. IUPAC name: 1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione. InChIKey: QTDKWGPEXSIHDE-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1,7-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
| InChIKey | QTDKWGPEXSIHDE-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2C(=O)NC(=O)N(C2=N1)C |
Computed by PubChem (NCBI)