CAS 223377-06-8 is the registry number for 3-[(3-Nitro-2-pyridinyl)amino]propanenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
3-[(3-nitro-2-pyridinyl)amino]propanenitrile (CAS 223377-06-8) is a chemical compound with the molecular formula C8H8N4O2 and a molecular weight of 192.17 g/mol. IUPAC name: 3-[(3-nitro-2-pyridinyl)amino]propanenitrile. InChIKey: KMGWUGWAZWGZOL-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O2 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-[(3-nitro-2-pyridinyl)amino]propanenitrile |
| InChIKey | KMGWUGWAZWGZOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NCCC#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)