Products 263758-69-6
CAS 263758-69-6 is the registry number for 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoic acid, 90%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoic acid (CAS 263758-69-6) is a chemical compound with the molecular formula C12H13NO7 and a molecular weight of 283.23 g/mol. IUPAC name: 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoic acid. InChIKey: HUWJSTCEZBSJIZ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO7 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 4-(4-formyl-2-methoxy-5-nitrophenoxy)butanoic acid |
| InChIKey | HUWJSTCEZBSJIZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCCCC(=O)O |
Computed by PubChem (NCBI)