CAS 1794300-26-7 is the registry number for 3-Methyl-1-phenyl-1H-pyrazolo(3,4-b)pyridin-5-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-amine;hydrochloride (CAS 1794300-26-7) is a chemical compound with the molecular formula C13H13ClN4 and a molecular weight of 260.72 g/mol. IUPAC name: 3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-amine;hydrochloride. InChIKey: ZBQGLEXLYNMLAJ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN4 |
|---|---|
| Molecular weight | 260.72 g/mol |
| IUPAC name | 3-methyl-1-phenylpyrazolo[5,4-b]pyridin-5-amine;hydrochloride |
| InChIKey | ZBQGLEXLYNMLAJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)N)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)