CAS 1794752-24-1 is the registry number for Ambroxol Cyclic Impurity–d5 Dihydrochloride. Offered by: GLPBio. Available pack sizes: 10mg.
1,2,2,6,6-pentadeuterio-4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol (CAS 1794752-24-1) is a chemical compound with the molecular formula C14H18Br2N2O and a molecular weight of 395.14 g/mol. IUPAC name: 1,2,2,6,6-pentadeuterio-4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol. InChIKey: AJOQVCHLLULVGK-KKMRROIFSA-N.
| Molecular formula | C14H18Br2N2O |
|---|---|
| Molecular weight | 395.14 g/mol |
| IUPAC name | 1,2,2,6,6-pentadeuterio-4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol |
| InChIKey | AJOQVCHLLULVGK-KKMRROIFSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])O)([2H])[2H])N2CC3=C(C(=CC(=C3)Br)Br)NC2)[2H] |
Computed by PubChem (NCBI)