CAS 3472-84-2 is the registry number for 2-Amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide (CAS 3472-84-2) is a chemical compound with the molecular formula C14H18Br2N2O and a molecular weight of 390.11 g/mol. IUPAC name: 2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide. InChIKey: ZRZXHSAMYICAQO-UHFFFAOYSA-N.
| Molecular formula | C14H18Br2N2O |
|---|---|
| Molecular weight | 390.11 g/mol |
| IUPAC name | 2-amino-3,5-dibromo-N-cyclohexyl-N-methylbenzamide |
| InChIKey | ZRZXHSAMYICAQO-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCC1)C(=O)C2=C(C(=CC(=C2)Br)Br)N |
Computed by PubChem (NCBI)